C24H27N7O5 — CID 123160353
2-[[4-[1-(2,4-diaminopteridin-6-yl)hex-4-en-2-yl]benzoyl]amino]pentanedioic acid (PubChem CID 123160353) has the molecular formula C24H27N7O5 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-[[4-[1-(2,4-diaminopteridin-6-yl)hex-4-en-2-yl]benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-[1-(2,4-diaminopteridin-6-yl)hex-4-en-2-yl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 123160353 |
| Molecular Formula | C24H27N7O5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 2-[[4-[1-(2,4-diaminopteridin-6-yl)hex-4-en-2-yl]benzoyl]amino]pentanedioic acid |
| SMILES | CC=CCC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C24H27N7O5/c1-2-3-4-15(11-16-12-27-21-19(28-16)20(25)30-24(26)31-21)13-5-7-14(8-6-13)22(34)29-17(23(35)36)9-10-18(32)33/h2-3,5-8,12,15,17H,4,9-11H2,1H3,(H,29,34)(H,32,33)(H,35,36)(H4,25,26,27,30,31) |
| InChIKey | FFNOYJGCLSILPW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 207.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|