C28H29N13O4 — CID 166938285
(2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]-5-[[4-methyl-2-(2H-tetrazol-5-yl)benzoyl]amino]pentanoic acid (PubChem CID 166938285) has the molecular formula C28H29N13O4 and a molecular weight of 611.63 g/mol. Its IUPAC name is (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]-5-[[4-methyl-2-(2H-tetrazol-5-yl)benzoyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]-5-[[4-methyl-2-(2H-tetrazol-5-yl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 166938285 |
| Molecular Formula | C28H29N13O4 |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]-5-[[4-methyl-2-(2H-tetrazol-5-yl)benzoyl]amino]pentanoic acid |
| SMILES | Cc1ccc(C(=O)NCCC[C@H](NC(=O)c2ccc(NCc3cnc4nc(N)nc(N)c4n3)cc2)C(=O)O)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C28H29N13O4/c1-14-4-9-18(19(11-14)23-38-40-41-39-23)26(43)31-10-2-3-20(27(44)45)35-25(42)15-5-7-16(8-6-15)32-12-17-13-33-24-21(34-17)22(29)36-28(30)37-24/h4-9,11,13,20,32H,2-3,10,12H2,1H3,(H,31,43)(H,35,42)(H,44,45)(H,38,39,40,41)(H4,29,30,33,36,37)/t20-/m0/s1 |
| InChIKey | PSHCAVMGSOWEOQ-FQEVSTJZSA-N |
| XLogP | 1.08 |
| TPSA | 265.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|