C32H36N12O4 — CID 165104666
(2S)-7-[4-tert-butyl-2-(2H-tetrazol-5-yl)phenyl]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]-7-oxoheptanoic acid (PubChem CID 165104666) has the molecular formula C32H36N12O4 and a molecular weight of 652.72 g/mol. Its IUPAC name is (2S)-7-[4-tert-butyl-2-(2H-tetrazol-5-yl)phenyl]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]-7-oxoheptanoic acid.
| Compound Name | (2S)-7-[4-tert-butyl-2-(2H-tetrazol-5-yl)phenyl]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 165104666 |
| Molecular Formula | C32H36N12O4 |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | (2S)-7-[4-tert-butyl-2-(2H-tetrazol-5-yl)phenyl]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]-7-oxoheptanoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)CCCC[C@H](NC(=O)c2ccc(NCc3cnc4nc(N)nc(N)c4n3)cc2)C(=O)O)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C32H36N12O4/c1-32(2,3)18-10-13-21(22(14-18)27-41-43-44-42-27)24(45)7-5-4-6-23(30(47)48)38-29(46)17-8-11-19(12-9-17)35-15-20-16-36-28-25(37-20)26(33)39-31(34)40-28/h8-14,16,23,35H,4-7,15H2,1-3H3,(H,38,46)(H,47,48)(H,41,42,43,44)(H4,33,34,36,39,40)/t23-/m0/s1 |
| InChIKey | YXTHSJKEAQXDHH-QHCPKHFHSA-N |
| XLogP | 3.30 |
| TPSA | 253.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|