C31H37N9O5 — CID 164741015
2-tert-butyl-5-[[(5S)-5-carboxy-5-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentyl]amino]benzoic acid (PubChem CID 164741015) has the molecular formula C31H37N9O5 and a molecular weight of 615.70 g/mol. Its IUPAC name is 2-tert-butyl-5-[[(5S)-5-carboxy-5-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentyl]amino]benzoic acid.
| Compound Name | 2-tert-butyl-5-[[(5S)-5-carboxy-5-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentyl]amino]benzoic acid |
|---|---|
| PubChem CID | 164741015 |
| Molecular Formula | C31H37N9O5 |
| Molecular Weight | 615.70 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | 2-tert-butyl-5-[[(5S)-5-carboxy-5-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentyl]amino]benzoic acid |
| SMILES | CC(C)(C)c1ccc(NCCCC[C@H](NC(=O)c2ccc(NCc3cnc4nc(N)nc(N)c4n3)cc2)C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C31H37N9O5/c1-31(2,3)22-12-11-19(14-21(22)28(42)43)34-13-5-4-6-23(29(44)45)38-27(41)17-7-9-18(10-8-17)35-15-20-16-36-26-24(37-20)25(32)39-30(33)40-26/h7-12,14,16,23,34-35H,4-6,13,15H2,1-3H3,(H,38,41)(H,42,43)(H,44,45)(H4,32,33,36,39,40)/t23-/m0/s1 |
| InChIKey | MLOSQCYVDGUCGI-QHCPKHFHSA-N |
| XLogP | 3.66 |
| TPSA | 231.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|