C30H35N9O5 — CID 164741043
(2S)-5-[(4-tert-butyl-2-hydroxybenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid (PubChem CID 164741043) has the molecular formula C30H35N9O5 and a molecular weight of 601.67 g/mol. Its IUPAC name is (2S)-5-[(4-tert-butyl-2-hydroxybenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-[(4-tert-butyl-2-hydroxybenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 164741043 |
| Molecular Formula | C30H35N9O5 |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | (2S)-5-[(4-tert-butyl-2-hydroxybenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCC[C@H](NC(=O)c2ccc(NCc3cnc4nc(N)nc(N)c4n3)cc2)C(=O)O)c(O)c1 |
| InChI | InChI=1S/C30H35N9O5/c1-30(2,3)17-8-11-20(22(40)13-17)27(42)33-12-4-5-21(28(43)44)37-26(41)16-6-9-18(10-7-16)34-14-19-15-35-25-23(36-19)24(31)38-29(32)39-25/h6-11,13,15,21,34,40H,4-5,12,14H2,1-3H3,(H,33,42)(H,37,41)(H,43,44)(H4,31,32,35,38,39)/t21-/m0/s1 |
| InChIKey | XRSKHIPKZQZETB-NRFANRHFSA-N |
| XLogP | 2.59 |
| TPSA | 231.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|