C30H31N9O8S2 — CID 157077021
(2R)-2-[2-[4-[2-(2,4-diaminopteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-[[(2R)-1-methoxy-3-[(3-nitro-2-pyridinyl)disulfanyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 157077021) has the molecular formula C30H31N9O8S2 and a molecular weight of 709.77 g/mol. Its IUPAC name is (2R)-2-[2-[4-[2-(2,4-diaminopteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-[[(2R)-1-methoxy-3-[(3-nitro-2-pyridinyl)disulfanyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-2-[2-[4-[2-(2,4-diaminopteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-[[(2R)-1-methoxy-3-[(3-nitro-2-pyridinyl)disulfanyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 157077021 |
| Molecular Formula | C30H31N9O8S2 |
| Molecular Weight | 709.77 g/mol |
| Exact Mass | 709.17 |
| IUPAC Name | (2R)-2-[2-[4-[2-(2,4-diaminopteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-[[(2R)-1-methoxy-3-[(3-nitro-2-pyridinyl)disulfanyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | COC(=O)[C@H](CSSc1ncccc1[N+](=O)[O-])NC(=O)CC[C@H](CC(=O)c1ccc(CCc2cnc3nc(N)nc(N)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C30H31N9O8S2/c1-47-29(44)20(15-48-49-27-21(39(45)46)3-2-12-33-27)36-23(41)11-9-18(28(42)43)13-22(40)17-7-4-16(5-8-17)6-10-19-14-34-26-24(35-19)25(31)37-30(32)38-26/h2-5,7-8,12,14,18,20H,6,9-11,13,15H2,1H3,(H,36,41)(H,42,43)(H4,31,32,34,37,38)/t18-,20+/m1/s1 |
| InChIKey | PBCRZOCJZLNBIZ-QUCCMNQESA-N |
| XLogP | 2.82 |
| TPSA | 269.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.77 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|