C24H28N8O8 — CID 158108776
1-O-methyl 5-O-(1-nitrooxyethyl) 2-[2-[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]phenyl]-2-oxoethyl]pentanedioate (PubChem CID 158108776) has the molecular formula C24H28N8O8 and a molecular weight of 556.54 g/mol. Its IUPAC name is 1-O-methyl 5-O-(1-nitrooxyethyl) 2-[2-[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]phenyl]-2-oxoethyl]pentanedioate.
| Compound Name | 1-O-methyl 5-O-(1-nitrooxyethyl) 2-[2-[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]phenyl]-2-oxoethyl]pentanedioate |
|---|---|
| PubChem CID | 158108776 |
| Molecular Formula | C24H28N8O8 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 1-O-methyl 5-O-(1-nitrooxyethyl) 2-[2-[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]phenyl]-2-oxoethyl]pentanedioate |
| SMILES | COC(=O)C(CCC(=O)OC(C)O[N+](=O)[O-])CC(=O)c1ccc(N(C)Cc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C24H28N8O8/c1-13(40-32(36)37)39-19(34)9-6-15(23(35)38-3)10-18(33)14-4-7-17(8-5-14)31(2)12-16-11-27-22-20(28-16)21(25)29-24(26)30-22/h4-5,7-8,11,13,15H,6,9-10,12H2,1-3H3,(H4,25,26,27,29,30) |
| InChIKey | JXSZZNVYAZXJGA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 228.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|