C32H42N6O5S2 — CID 158321993
(2R)-2-[2-[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-[2-[(6-methyl-5-methylideneheptan-2-yl)disulfanyl]ethylamino]-5-oxopentanoic acid (PubChem CID 158321993) has the molecular formula C32H42N6O5S2 and a molecular weight of 654.86 g/mol. Its IUPAC name is (2R)-2-[2-[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-[2-[(6-methyl-5-methylideneheptan-2-yl)disulfanyl]ethylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-2-[2-[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-[2-[(6-methyl-5-methylideneheptan-2-yl)disulfanyl]ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 158321993 |
| Molecular Formula | C32H42N6O5S2 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | (2R)-2-[2-[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-[2-[(6-methyl-5-methylideneheptan-2-yl)disulfanyl]ethylamino]-5-oxopentanoic acid |
| SMILES | C=C(CCC(C)SSCCNC(=O)CC[C@H](CC(=O)c1ccc(CCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O)C(C)C |
| InChI | InChI=1S/C32H42N6O5S2/c1-19(2)20(3)5-6-21(4)45-44-16-15-34-27(40)14-12-24(31(42)43)17-26(39)23-10-7-22(8-11-23)9-13-25-18-35-29-28(36-25)30(41)38-32(33)37-29/h7-8,10-11,18-19,21,24H,3,5-6,9,12-17H2,1-2,4H3,(H,34,40)(H,42,43)(H3,33,35,37,38,41)/t21?,24-/m1/s1 |
| InChIKey | KKTDMBYJCOSSEQ-MQNHUJCZSA-N |
| XLogP | 5.01 |
| TPSA | 181.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|