C20H20N6O6 — CID 160888708
4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]-N-propylbenzamide;bis(carbon dioxide) (PubChem CID 160888708) has the molecular formula C20H20N6O6 and a molecular weight of 440.42 g/mol. Its IUPAC name is 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]-N-propylbenzamide;bis(carbon dioxide).
| Compound Name | 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]-N-propylbenzamide;bis(carbon dioxide) |
|---|---|
| PubChem CID | 160888708 |
| Molecular Formula | C20H20N6O6 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]-N-propylbenzamide;bis(carbon dioxide) |
| SMILES | CCCNC(=O)c1ccc(CCc2cnc3nc(N)[nH]c(=O)c3n2)cc1.O=C=O.O=C=O |
| InChI | InChI=1S/C18H20N6O2.2CO2/c1-2-9-20-16(25)12-6-3-11(4-7-12)5-8-13-10-21-15-14(22-13)17(26)24-18(19)23-15;2*2-1-3/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,20,25)(H3,19,21,23,24,26);; |
| InChIKey | SNZAGCZJIJWCNZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 194.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |