C17H17N5O3 — CID 135692615
ethyl 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]benzoate (PubChem CID 135692615) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is ethyl 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]benzoate.
| Compound Name | ethyl 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 135692615 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | ethyl 4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCc2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C17H17N5O3/c1-2-25-16(24)11-6-3-10(4-7-11)5-8-12-9-19-14-13(20-12)15(23)22-17(18)21-14/h3-4,6-7,9H,2,5,8H2,1H3,(H3,18,19,21,22,23) |
| InChIKey | DDEVIPKERNOHJH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |