C14H14N6O3 — CID 157066962
4-aminobenzoic acid;2-amino-6-methyl-3H-pteridin-4-one (PubChem CID 157066962) has the molecular formula C14H14N6O3 and a molecular weight of 314.31 g/mol. Its IUPAC name is 4-aminobenzoic acid;2-amino-6-methyl-3H-pteridin-4-one.
| Compound Name | 4-aminobenzoic acid;2-amino-6-methyl-3H-pteridin-4-one |
|---|---|
| PubChem CID | 157066962 |
| Molecular Formula | C14H14N6O3 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-aminobenzoic acid;2-amino-6-methyl-3H-pteridin-4-one |
| SMILES | Cc1cnc2nc(N)[nH]c(=O)c2n1.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C7H7N5O.C7H7NO2/c1-3-2-9-5-4(10-3)6(13)12-7(8)11-5;8-6-3-1-5(2-4-6)7(9)10/h2H,1H3,(H3,8,9,11,12,13);1-4H,8H2,(H,9,10) |
| InChIKey | ABZHRVPBMPOFFY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 160.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|