C32H46N6O4 — CID 137062302
2-amino-6-[4-[4-[2-ethyl-2-[(6-ethyl-6-hydroxy-5-oxooctan-2-yl)amino]butanoyl]phenyl]butyl]-3H-pteridin-4-one (PubChem CID 137062302) has the molecular formula C32H46N6O4 and a molecular weight of 578.76 g/mol. Its IUPAC name is 2-amino-6-[4-[4-[2-ethyl-2-[(6-ethyl-6-hydroxy-5-oxooctan-2-yl)amino]butanoyl]phenyl]butyl]-3H-pteridin-4-one.
| Compound Name | 2-amino-6-[4-[4-[2-ethyl-2-[(6-ethyl-6-hydroxy-5-oxooctan-2-yl)amino]butanoyl]phenyl]butyl]-3H-pteridin-4-one |
|---|---|
| PubChem CID | 137062302 |
| Molecular Formula | C32H46N6O4 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | 2-amino-6-[4-[4-[2-ethyl-2-[(6-ethyl-6-hydroxy-5-oxooctan-2-yl)amino]butanoyl]phenyl]butyl]-3H-pteridin-4-one |
| SMILES | CCC(O)(CC)C(=O)CCC(C)NC(CC)(CC)C(=O)c1ccc(CCCCc2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C32H46N6O4/c1-6-31(7-2,38-21(5)14-19-25(39)32(42,8-3)9-4)27(40)23-17-15-22(16-18-23)12-10-11-13-24-20-34-28-26(35-24)29(41)37-30(33)36-28/h15-18,20-21,38,42H,6-14,19H2,1-5H3,(H3,33,34,36,37,41) |
| InChIKey | KPQPTNXVHIZNTF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|