C33H40N8O11S2 — CID 159041239
5-[[2-amino-3-[[6-[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]phenyl]-4-carboxy-6-oxohexanoyl]amino]propanoyl]amino]-2-[(methyldisulfanyl)methyl]-4-oxoheptanedioic acid (PubChem CID 159041239) has the molecular formula C33H40N8O11S2 and a molecular weight of 788.86 g/mol. Its IUPAC name is 5-[[2-amino-3-[[6-[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]phenyl]-4-carboxy-6-oxohexanoyl]amino]propanoyl]amino]-2-[(methyldisulfanyl)methyl]-4-oxoheptanedioic acid.
| Compound Name | 5-[[2-amino-3-[[6-[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]phenyl]-4-carboxy-6-oxohexanoyl]amino]propanoyl]amino]-2-[(methyldisulfanyl)methyl]-4-oxoheptanedioic acid |
|---|---|
| PubChem CID | 159041239 |
| Molecular Formula | C33H40N8O11S2 |
| Molecular Weight | 788.86 g/mol |
| Exact Mass | 788.23 |
| IUPAC Name | 5-[[2-amino-3-[[6-[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethyl]phenyl]-4-carboxy-6-oxohexanoyl]amino]propanoyl]amino]-2-[(methyldisulfanyl)methyl]-4-oxoheptanedioic acid |
| SMILES | CSSCC(CC(=O)C(CC(=O)O)NC(=O)C(N)CNC(=O)CCC(CC(=O)c1ccc(CCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C33H40N8O11S2/c1-53-54-15-19(32(51)52)11-24(43)22(12-26(45)46)39-29(47)21(34)14-36-25(44)9-7-18(31(49)50)10-23(42)17-5-2-16(3-6-17)4-8-20-13-37-28-27(38-20)30(48)41-33(35)40-28/h2-3,5-6,13,18-19,21-22H,4,7-12,14-15,34H2,1H3,(H,36,44)(H,39,47)(H,45,46)(H,49,50)(H,51,52)(H3,35,37,40,41,48) |
| InChIKey | XJJFUFYGMXUSQD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 327.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.86 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|