4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid

C15H14N6O2S — CID 12658994

IUPAC4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid
SMILESNc1nc(N)c2nc(CCSc3ccc(C(=O)O)cc3)cnc2n1
InChIInChI=1S/C15H14N6O2S/c16-12-11-13(21-15(17)20-12)18-7-9(19-11)5-6-24-10-3-1-8(2-4-10)14(22)23/h1-4,7H,5-6H2,(H,22,23)(H4,16,17,18,20,21)
InChIKeyZTOXAVMHQGAQFJ-UHFFFAOYSA-N
MW342.38 g/mol
LogP1.62
Rot. Bonds5

About 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid

4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid (PubChem CID 12658994) has the molecular formula C15H14N6O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid.

Molecular Properties

Compound Name4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid
PubChem CID12658994
Molecular FormulaC15H14N6O2S
Molecular Weight342.38 g/mol
Exact Mass342.09
IUPAC Name4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid
SMILESNc1nc(N)c2nc(CCSc3ccc(C(=O)O)cc3)cnc2n1
InChIInChI=1S/C15H14N6O2S/c16-12-11-13(21-15(17)20-12)18-7-9(19-11)5-6-24-10-3-1-8(2-4-10)14(22)23/h1-4,7H,5-6H2,(H,22,23)(H4,16,17,18,20,21)
InChIKeyZTOXAVMHQGAQFJ-UHFFFAOYSA-N
XLogP1.62
TPSA140.90 Ų
H-Bond Donors3
H-Bond Acceptors8
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.38
LogP ≤ 51.62
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 108

Analyze 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid?
The IUPAC name of 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid (CID 12658994) is 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid.
What is the SMILES notation for 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid?
The canonical SMILES for 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid is Nc1nc(N)c2nc(CCSc3ccc(C(=O)O)cc3)cnc2n1.
What is the InChIKey of 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid?
The InChIKey is ZTOXAVMHQGAQFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N6O2S/c16-12-11-13(21-15(17)20-12)18-7-9(19-11)5-6-24-10-3-1-8(2-4-10)14(22)23/h1-4,7H,5-6H2,(H,22,23)(H4,16,17,18,20,21).
What are the key properties of 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid?
4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid has a molecular weight of 342.38 g/mol, XLogP of 1.62, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid is sourced from PubChem (CID 12658994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).