C15H14N6O2S — CID 12658994
4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid (PubChem CID 12658994) has the molecular formula C15H14N6O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid.
| Compound Name | 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 12658994 |
| Molecular Formula | C15H14N6O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-[2-(2,4-diaminopteridin-6-yl)ethylsulfanyl]benzoic acid |
| SMILES | Nc1nc(N)c2nc(CCSc3ccc(C(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C15H14N6O2S/c16-12-11-13(21-15(17)20-12)18-7-9(19-11)5-6-24-10-3-1-8(2-4-10)14(22)23/h1-4,7H,5-6H2,(H,22,23)(H4,16,17,18,20,21) |
| InChIKey | ZTOXAVMHQGAQFJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |