C18H18N6O4 — CID 123386629
4-[2-carboxy-1-(2,4-diaminopteridin-6-yl)butan-2-yl]benzoic acid (PubChem CID 123386629) has the molecular formula C18H18N6O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is 4-[2-carboxy-1-(2,4-diaminopteridin-6-yl)butan-2-yl]benzoic acid.
| Compound Name | 4-[2-carboxy-1-(2,4-diaminopteridin-6-yl)butan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 123386629 |
| Molecular Formula | C18H18N6O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-[2-carboxy-1-(2,4-diaminopteridin-6-yl)butan-2-yl]benzoic acid |
| SMILES | CCC(Cc1cnc2nc(N)nc(N)c2n1)(C(=O)O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H18N6O4/c1-2-18(16(27)28,10-5-3-9(4-6-10)15(25)26)7-11-8-21-14-12(22-11)13(19)23-17(20)24-14/h3-6,8H,2,7H2,1H3,(H,25,26)(H,27,28)(H4,19,20,21,23,24) |
| InChIKey | QPBVLRCLFSWYHY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 178.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |