C14H11Cl2N7O2 — CID 10022649
3,5-dichloro-4-[(2,4-diaminopteridin-6-yl)methylamino]benzoic acid (PubChem CID 10022649) has the molecular formula C14H11Cl2N7O2 and a molecular weight of 380.20 g/mol. Its IUPAC name is 3,5-dichloro-4-[(2,4-diaminopteridin-6-yl)methylamino]benzoic acid.
| Compound Name | 3,5-dichloro-4-[(2,4-diaminopteridin-6-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 10022649 |
| Molecular Formula | C14H11Cl2N7O2 |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 3,5-dichloro-4-[(2,4-diaminopteridin-6-yl)methylamino]benzoic acid |
| SMILES | Nc1nc(N)c2nc(CNc3c(Cl)cc(C(=O)O)cc3Cl)cnc2n1 |
| InChI | InChI=1S/C14H11Cl2N7O2/c15-7-1-5(13(24)25)2-8(16)9(7)19-3-6-4-20-12-10(21-6)11(17)22-14(18)23-12/h1-2,4,19H,3H2,(H,24,25)(H4,17,18,20,22,23) |
| InChIKey | AKNLZOOFKCHMKS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |