C22H22N8O4S — CID 46913625
4-[2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]ethyl]benzenesulfonic acid (PubChem CID 46913625) has the molecular formula C22H22N8O4S and a molecular weight of 494.54 g/mol. Its IUPAC name is 4-[2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]ethyl]benzenesulfonic acid.
| Compound Name | 4-[2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 46913625 |
| Molecular Formula | C22H22N8O4S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 4-[2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]ethyl]benzenesulfonic acid |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(C(=O)NCCc4ccc(S(=O)(=O)O)cc4)cc3)cnc2n1 |
| InChI | InChI=1S/C22H22N8O4S/c23-19-18-20(30-22(24)29-19)27-12-16(28-18)11-26-15-5-3-14(4-6-15)21(31)25-10-9-13-1-7-17(8-2-13)35(32,33)34/h1-8,12,26H,9-11H2,(H,25,31)(H,32,33,34)(H4,23,24,27,29,30) |
| InChIKey | NUXDNXKKRSNKHH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 199.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|