C28H28N14O3P+ — CID 123244205
bis[[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]methoxy]-oxophosphanium (PubChem CID 123244205) has the molecular formula C28H28N14O3P+ and a molecular weight of 639.60 g/mol. Its IUPAC name is bis[[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]methoxy]-oxophosphanium.
| Compound Name | bis[[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 123244205 |
| Molecular Formula | C28H28N14O3P+ |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | bis[[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]methoxy]-oxophosphanium |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(CO[P+](=O)OCc4ccc(NCc5cnc6nc(N)nc(N)c6n5)cc4)cc3)cnc2n1 |
| InChI | InChI=1S/C28H28N14O3P/c29-23-21-25(41-27(31)39-23)35-11-19(37-21)9-33-17-5-1-15(2-6-17)13-44-46(43)45-14-16-3-7-18(8-4-16)34-10-20-12-36-26-22(38-20)24(30)40-28(32)42-26/h1-8,11-12,33-34H,9-10,13-14H2,(H4,29,31,35,39,41)(H4,30,32,36,40,42)/q+1 |
| InChIKey | ABGXPKJEEHLKSD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 266.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|