About tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate
tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 58847294) has the molecular formula C20H25N7O3
and a molecular weight of 411.47 g/mol. Its IUPAC name is tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate |
| PubChem CID | 58847294 |
| Molecular Formula | C20H25N7O3 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccc(O)cc1)NCc1cnc2nc(N)nc(N)c2n1 |
| InChI | InChI=1S/C20H25N7O3/c1-20(2,3)30-18(29)14(8-11-4-6-13(28)7-5-11)23-9-12-10-24-17-15(25-12)16(21)26-19(22)27-17/h4-7,10,14,23,28H,8-9H2,1-3H3,(H4,21,22,24,26,27) |
| InChIKey | ONJMDMUUJIHJHY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate?
The IUPAC name of tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate (CID 58847294) is tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate.
What is the SMILES notation for tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate?
The canonical SMILES for tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate is CC(C)(C)OC(=O)C(Cc1ccc(O)cc1)NCc1cnc2nc(N)nc(N)c2n1.
What is the InChIKey of tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate?
The InChIKey is ONJMDMUUJIHJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N7O3/c1-20(2,3)30-18(29)14(8-11-4-6-13(28)7-5-11)23-9-12-10-24-17-15(25-12)16(21)26-19(22)27-17/h4-7,10,14,23,28H,8-9H2,1-3H3,(H4,21,22,24,26,27).
What are the key properties of tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate?
tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate has a molecular weight of 411.47 g/mol, XLogP of 1.33, 6 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(2,4-diaminopteridin-6-yl)methylamino]-3-(4-hydroxyphenyl)propanoate is sourced from PubChem (CID 58847294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).