C8H9N7O — CID 58996351
6-[(methylideneamino)oxymethyl]pteridine-2,4-diamine (PubChem CID 58996351) has the molecular formula C8H9N7O and a molecular weight of 219.21 g/mol. Its IUPAC name is 6-[(methylideneamino)oxymethyl]pteridine-2,4-diamine.
| Compound Name | 6-[(methylideneamino)oxymethyl]pteridine-2,4-diamine |
|---|---|
| PubChem CID | 58996351 |
| Molecular Formula | C8H9N7O |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 6-[(methylideneamino)oxymethyl]pteridine-2,4-diamine |
| SMILES | C=NOCc1cnc2nc(N)nc(N)c2n1 |
| InChI | InChI=1S/C8H9N7O/c1-11-16-3-4-2-12-7-5(13-4)6(9)14-8(10)15-7/h2H,1,3H2,(H4,9,10,12,14,15) |
| InChIKey | ADKGKZNDDQLWGH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|