C7H6N6O — CID 3080607
2,4-diaminopteridine-6-carbaldehyde (PubChem CID 3080607) has the molecular formula C7H6N6O and a molecular weight of 190.17 g/mol. Its IUPAC name is 2,4-diaminopteridine-6-carbaldehyde.
| Compound Name | 2,4-diaminopteridine-6-carbaldehyde |
|---|---|
| PubChem CID | 3080607 |
| Molecular Formula | C7H6N6O |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2,4-diaminopteridine-6-carbaldehyde |
| SMILES | Nc1nc(N)c2nc(C=O)cnc2n1 |
| InChI | InChI=1S/C7H6N6O/c8-5-4-6(13-7(9)12-5)10-1-3(2-14)11-4/h1-2H,(H4,8,9,10,12,13) |
| InChIKey | QBSIXCBKOMWSBZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|