C25H21N6P — CID 13472696
6-[(triphenyl-lambda5-phosphanylidene)methyl]pteridine-2,4-diamine (PubChem CID 13472696) has the molecular formula C25H21N6P and a molecular weight of 436.46 g/mol. Its IUPAC name is 6-[(triphenyl-lambda5-phosphanylidene)methyl]pteridine-2,4-diamine.
| Compound Name | 6-[(triphenyl-lambda5-phosphanylidene)methyl]pteridine-2,4-diamine |
|---|---|
| PubChem CID | 13472696 |
| Molecular Formula | C25H21N6P |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 6-[(triphenyl-lambda5-phosphanylidene)methyl]pteridine-2,4-diamine |
| SMILES | Nc1nc(N)c2nc(C=P(c3ccccc3)(c3ccccc3)c3ccccc3)cnc2n1 |
| InChI | InChI=1S/C25H21N6P/c26-23-22-24(31-25(27)30-23)28-16-18(29-22)17-32(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17H,(H4,26,27,28,30,31) |
| InChIKey | GNGOSQJKTYKWDV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|