C18H13N5 — CID 15313166
2,6-diphenylpteridin-4-amine (PubChem CID 15313166) has the molecular formula C18H13N5 and a molecular weight of 299.34 g/mol. Its IUPAC name is 2,6-diphenylpteridin-4-amine.
| Compound Name | 2,6-diphenylpteridin-4-amine |
|---|---|
| PubChem CID | 15313166 |
| Molecular Formula | C18H13N5 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2,6-diphenylpteridin-4-amine |
| SMILES | Nc1nc(-c2ccccc2)nc2ncc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C18H13N5/c19-16-15-18(23-17(22-16)13-9-5-2-6-10-13)20-11-14(21-15)12-7-3-1-4-8-12/h1-11H,(H2,19,20,22,23) |
| InChIKey | PBDIBKDFKRLTMZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |