C17H17N5 — CID 129404127
(7S)-7-methyl-2-phenyl-6,7,8,9-tetrahydrobenzo[g]pteridin-4-amine (PubChem CID 129404127) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is (7S)-7-methyl-2-phenyl-6,7,8,9-tetrahydrobenzo[g]pteridin-4-amine.
| Compound Name | (7S)-7-methyl-2-phenyl-6,7,8,9-tetrahydrobenzo[g]pteridin-4-amine |
|---|---|
| PubChem CID | 129404127 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (7S)-7-methyl-2-phenyl-6,7,8,9-tetrahydrobenzo[g]pteridin-4-amine |
| SMILES | C[C@H]1CCc2nc3nc(-c4ccccc4)nc(N)c3nc2C1 |
| InChI | InChI=1S/C17H17N5/c1-10-7-8-12-13(9-10)19-14-15(18)21-16(22-17(14)20-12)11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H2,18,20,21,22)/t10-/m0/s1 |
| InChIKey | OWYCGCZFDIXJBK-JTQLQIEISA-N |
| XLogP | 2.79 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |