C17H12N4S — CID 155543719
2,5-diphenyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 155543719) has the molecular formula C17H12N4S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2,5-diphenyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
| Compound Name | 2,5-diphenyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 155543719 |
| Molecular Formula | C17H12N4S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2,5-diphenyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | Nc1nc(-c2ccccc2)nc2sc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C17H12N4S/c18-14-13-17(21-15(20-14)11-7-3-1-4-8-11)22-16(19-13)12-9-5-2-6-10-12/h1-10H,(H2,18,20,21) |
| InChIKey | CCWIRVKMRZKCHH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |