C22H23N3S — CID 143976514
ethane;2-phenyl-6-(2-phenylethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 143976514) has the molecular formula C22H23N3S and a molecular weight of 361.51 g/mol. Its IUPAC name is ethane;2-phenyl-6-(2-phenylethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | ethane;2-phenyl-6-(2-phenylethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143976514 |
| Molecular Formula | C22H23N3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | ethane;2-phenyl-6-(2-phenylethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC.Nc1nc(-c2ccccc2)nc2sc(CCc3ccccc3)cc12 |
| InChI | InChI=1S/C20H17N3S.C2H6/c21-18-17-13-16(12-11-14-7-3-1-4-8-14)24-20(17)23-19(22-18)15-9-5-2-6-10-15;1-2/h1-10,13H,11-12H2,(H2,21,22,23);1-2H3 |
| InChIKey | BHONJJFQYXKWPZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |