C18H12ClFN4S — CID 45275186
6-[(6-chloro-3-pyridinyl)methyl]-2-(3-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 45275186) has the molecular formula C18H12ClFN4S and a molecular weight of 370.84 g/mol. Its IUPAC name is 6-[(6-chloro-3-pyridinyl)methyl]-2-(3-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-[(6-chloro-3-pyridinyl)methyl]-2-(3-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 45275186 |
| Molecular Formula | C18H12ClFN4S |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 6-[(6-chloro-3-pyridinyl)methyl]-2-(3-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2cccc(F)c2)nc2sc(Cc3ccc(Cl)nc3)cc12 |
| InChI | InChI=1S/C18H12ClFN4S/c19-15-5-4-10(9-22-15)6-13-8-14-16(21)23-17(24-18(14)25-13)11-2-1-3-12(20)7-11/h1-5,7-9H,6H2,(H2,21,23,24) |
| InChIKey | BRQZGQYCNJGZLR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|