C14H11F2N3S — CID 63615139
2-(3,4-difluorophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 63615139) has the molecular formula C14H11F2N3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(3,4-difluorophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63615139 |
| Molecular Formula | C14H11F2N3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-(3,4-difluorophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(N)nc(-c3ccc(F)c(F)c3)nc2s1 |
| InChI | InChI=1S/C14H11F2N3S/c1-2-8-6-9-12(17)18-13(19-14(9)20-8)7-3-4-10(15)11(16)5-7/h3-6H,2H2,1H3,(H2,17,18,19) |
| InChIKey | GCIWZVCOKYKFAJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |