C11H8BrF2N3 — CID 66304664
5-bromo-2-(3,4-difluorophenyl)-6-methylpyrimidin-4-amine (PubChem CID 66304664) has the molecular formula C11H8BrF2N3 and a molecular weight of 300.11 g/mol. Its IUPAC name is 5-bromo-2-(3,4-difluorophenyl)-6-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(3,4-difluorophenyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66304664 |
| Molecular Formula | C11H8BrF2N3 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 5-bromo-2-(3,4-difluorophenyl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1nc(-c2ccc(F)c(F)c2)nc(N)c1Br |
| InChI | InChI=1S/C11H8BrF2N3/c1-5-9(12)10(15)17-11(16-5)6-2-3-7(13)8(14)4-6/h2-4H,1H3,(H2,15,16,17) |
| InChIKey | PGIQWAFFKBRXBO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |