C9H5BrF2N2O — CID 79556113
4-bromo-5-(3,4-difluorophenyl)-1,2-oxazol-3-amine (PubChem CID 79556113) has the molecular formula C9H5BrF2N2O and a molecular weight of 275.05 g/mol. Its IUPAC name is 4-bromo-5-(3,4-difluorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-bromo-5-(3,4-difluorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 79556113 |
| Molecular Formula | C9H5BrF2N2O |
| Molecular Weight | 275.05 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 4-bromo-5-(3,4-difluorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccc(F)c(F)c2)c1Br |
| InChI | InChI=1S/C9H5BrF2N2O/c10-7-8(15-14-9(7)13)4-1-2-5(11)6(12)3-4/h1-3H,(H2,13,14) |
| InChIKey | UKDBIIVGDBXHIM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.05 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |