C9H2BrF5N2O — CID 79555618
4-bromo-5-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazol-3-amine (PubChem CID 79555618) has the molecular formula C9H2BrF5N2O and a molecular weight of 329.02 g/mol. Its IUPAC name is 4-bromo-5-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-bromo-5-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 79555618 |
| Molecular Formula | C9H2BrF5N2O |
| Molecular Weight | 329.02 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | 4-bromo-5-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2c(F)c(F)c(F)c(F)c2F)c1Br |
| InChI | InChI=1S/C9H2BrF5N2O/c10-2-8(18-17-9(2)16)1-3(11)5(13)7(15)6(14)4(1)12/h(H2,16,17) |
| InChIKey | DQOUHFSHEYFOKH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.02 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|