C10H6BrF3N2O — CID 79557110
4-bromo-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine (PubChem CID 79557110) has the molecular formula C10H6BrF3N2O and a molecular weight of 307.07 g/mol. Its IUPAC name is 4-bromo-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine.
| Compound Name | 4-bromo-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 79557110 |
| Molecular Formula | C10H6BrF3N2O |
| Molecular Weight | 307.07 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 4-bromo-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2cccc(C(F)(F)F)c2)c1Br |
| InChI | InChI=1S/C10H6BrF3N2O/c11-7-8(17-16-9(7)15)5-2-1-3-6(4-5)10(12,13)14/h1-4H,(H2,15,16) |
| InChIKey | MXZGYYJAICMDKK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.07 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |