C9H6F3N5 — CID 12535593
6-[3-(trifluoromethyl)phenyl]-1,2,4,5-tetrazin-3-amine (PubChem CID 12535593) has the molecular formula C9H6F3N5 and a molecular weight of 241.18 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)phenyl]-1,2,4,5-tetrazin-3-amine.
| Compound Name | 6-[3-(trifluoromethyl)phenyl]-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 12535593 |
| Molecular Formula | C9H6F3N5 |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 6-[3-(trifluoromethyl)phenyl]-1,2,4,5-tetrazin-3-amine |
| SMILES | Nc1nnc(-c2cccc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C9H6F3N5/c10-9(11,12)6-3-1-2-5(4-6)7-14-16-8(13)17-15-7/h1-4H,(H2,13,16,17) |
| InChIKey | QMWBVEQFFRCNCH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |