C15H15N3S2 — CID 106849494
6-ethyl-2-(4-methylsulfanylphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 106849494) has the molecular formula C15H15N3S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 6-ethyl-2-(4-methylsulfanylphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-(4-methylsulfanylphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106849494 |
| Molecular Formula | C15H15N3S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 6-ethyl-2-(4-methylsulfanylphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(N)nc(-c3ccc(SC)cc3)nc2s1 |
| InChI | InChI=1S/C15H15N3S2/c1-3-10-8-12-13(16)17-14(18-15(12)20-10)9-4-6-11(19-2)7-5-9/h4-8H,3H2,1-2H3,(H2,16,17,18) |
| InChIKey | AIWXECYHHASPFH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |