C19H19N5S — CID 143976488
ethane;2-phenyl-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 143976488) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is ethane;2-phenyl-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | ethane;2-phenyl-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143976488 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | ethane;2-phenyl-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC.Nc1nc(-c2ccccc2)nc2sc(Cc3cnccn3)cc12 |
| InChI | InChI=1S/C17H13N5S.C2H6/c18-15-14-9-13(8-12-10-19-6-7-20-12)23-17(14)22-16(21-15)11-4-2-1-3-5-11;1-2/h1-7,9-10H,8H2,(H2,18,21,22);1-2H3 |
| InChIKey | VFGLTGZLXRHRMZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |