C39H23N9 — CID 155765285
4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-phenyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene (PubChem CID 155765285) has the molecular formula C39H23N9 and a molecular weight of 617.68 g/mol. Its IUPAC name is 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-phenyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene.
| Compound Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-phenyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene |
|---|---|
| PubChem CID | 155765285 |
| Molecular Formula | C39H23N9 |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-phenyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene |
| SMILES | c1ccc(-c2cnc3c4ncc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)nc4c4nccnc4c3n2)cc1 |
| InChI | InChI=1S/C39H23N9/c1-4-10-24(11-5-1)29-22-42-33-34-36(32-31(35(33)44-29)40-20-21-41-32)45-30(23-43-34)25-16-18-28(19-17-25)39-47-37(26-12-6-2-7-13-26)46-38(48-39)27-14-8-3-9-15-27/h1-23H |
| InChIKey | XCDXSFUYLXJIEO-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|