C12H8N4O2 — CID 131845977
3-phenyl-6,7-dihydropyrazino[2,3-d]pyridazine-5,8-dione (PubChem CID 131845977) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-phenyl-6,7-dihydropyrazino[2,3-d]pyridazine-5,8-dione.
| Compound Name | 3-phenyl-6,7-dihydropyrazino[2,3-d]pyridazine-5,8-dione |
|---|---|
| PubChem CID | 131845977 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-phenyl-6,7-dihydropyrazino[2,3-d]pyridazine-5,8-dione |
| SMILES | O=c1[nH][nH]c(=O)c2nc(-c3ccccc3)cnc12 |
| InChI | InChI=1S/C12H8N4O2/c17-11-9-10(12(18)16-15-11)14-8(6-13-9)7-4-2-1-3-5-7/h1-6H,(H,15,17)(H,16,18) |
| InChIKey | MRMWJJLJTIMYLX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |