C12H9N5 — CID 10513277
6-phenylpteridin-4-amine (PubChem CID 10513277) has the molecular formula C12H9N5 and a molecular weight of 223.24 g/mol. Its IUPAC name is 6-phenylpteridin-4-amine.
| Compound Name | 6-phenylpteridin-4-amine |
|---|---|
| PubChem CID | 10513277 |
| Molecular Formula | C12H9N5 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 6-phenylpteridin-4-amine |
| SMILES | Nc1ncnc2ncc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C12H9N5/c13-11-10-12(16-7-15-11)14-6-9(17-10)8-4-2-1-3-5-8/h1-7H,(H2,13,14,15,16) |
| InChIKey | FXKPEYTWAKGVLS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |