C16H13N7O4S — CID 68768556
6-pyridin-2-yl-7-pyridin-3-ylpteridin-4-amine;sulfuric acid (PubChem CID 68768556) has the molecular formula C16H13N7O4S and a molecular weight of 399.39 g/mol. Its IUPAC name is 6-pyridin-2-yl-7-pyridin-3-ylpteridin-4-amine;sulfuric acid.
| Compound Name | 6-pyridin-2-yl-7-pyridin-3-ylpteridin-4-amine;sulfuric acid |
|---|---|
| PubChem CID | 68768556 |
| Molecular Formula | C16H13N7O4S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 6-pyridin-2-yl-7-pyridin-3-ylpteridin-4-amine;sulfuric acid |
| SMILES | Nc1ncnc2nc(-c3cccnc3)c(-c3ccccn3)nc12.O=S(=O)(O)O |
| InChI | InChI=1S/C16H11N7.H2O4S/c17-15-14-16(21-9-20-15)23-12(10-4-3-6-18-8-10)13(22-14)11-5-1-2-7-19-11;1-5(2,3)4/h1-9H,(H2,17,20,21,23);(H2,1,2,3,4) |
| InChIKey | SSRGYVKDIRZTNL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 177.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|