C19H17N5O5S — CID 86594138
3-[4-amino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol;methanesulfonic acid (PubChem CID 86594138) has the molecular formula C19H17N5O5S and a molecular weight of 427.44 g/mol. Its IUPAC name is 3-[4-amino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol;methanesulfonic acid.
| Compound Name | 3-[4-amino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol;methanesulfonic acid |
|---|---|
| PubChem CID | 86594138 |
| Molecular Formula | C19H17N5O5S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-[4-amino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Nc1ncnc2nc(-c3cccc(O)c3)c(-c3cccc(O)c3)nc12 |
| InChI | InChI=1S/C18H13N5O2.CH4O3S/c19-17-16-18(21-9-20-17)23-15(11-4-2-6-13(25)8-11)14(22-16)10-3-1-5-12(24)7-10;1-5(2,3)4/h1-9,24-25H,(H2,19,20,21,23);1H3,(H,2,3,4) |
| InChIKey | UMNIVNGBBIIEFX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 172.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|