C19H16N6O2 — CID 176623250
3-[[2,4-diamino-6-(3-hydroxyphenyl)pteridin-7-yl]methyl]phenol (PubChem CID 176623250) has the molecular formula C19H16N6O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is 3-[[2,4-diamino-6-(3-hydroxyphenyl)pteridin-7-yl]methyl]phenol.
| Compound Name | 3-[[2,4-diamino-6-(3-hydroxyphenyl)pteridin-7-yl]methyl]phenol |
|---|---|
| PubChem CID | 176623250 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-[[2,4-diamino-6-(3-hydroxyphenyl)pteridin-7-yl]methyl]phenol |
| SMILES | Nc1nc(N)c2nc(-c3cccc(O)c3)c(Cc3cccc(O)c3)nc2n1 |
| InChI | InChI=1S/C19H16N6O2/c20-17-16-18(25-19(21)24-17)22-14(8-10-3-1-5-12(26)7-10)15(23-16)11-4-2-6-13(27)9-11/h1-7,9,26-27H,8H2,(H4,20,21,22,24,25) |
| InChIKey | CKKVHCRNMDIMFV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |