C18H14BrN5O2 — CID 69016478
3-[4-amino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol;hydrobromide (PubChem CID 69016478) has the molecular formula C18H14BrN5O2 and a molecular weight of 412.25 g/mol. Its IUPAC name is 3-[4-amino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol;hydrobromide.
| Compound Name | 3-[4-amino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol;hydrobromide |
|---|---|
| PubChem CID | 69016478 |
| Molecular Formula | C18H14BrN5O2 |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 3-[4-amino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol;hydrobromide |
| SMILES | Br.Nc1ncnc2nc(-c3cccc(O)c3)c(-c3cccc(O)c3)nc12 |
| InChI | InChI=1S/C18H13N5O2.BrH/c19-17-16-18(21-9-20-17)23-15(11-4-2-6-13(25)8-11)14(22-16)10-3-1-5-12(24)7-10;/h1-9,24-25H,(H2,19,20,21,23);1H |
| InChIKey | SCNYOAPAAXTMJF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |