C14H18N2O — CID 115037876
3-(2-tert-butyl-5-methyl-1H-imidazol-4-yl)phenol (PubChem CID 115037876) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(2-tert-butyl-5-methyl-1H-imidazol-4-yl)phenol.
| Compound Name | 3-(2-tert-butyl-5-methyl-1H-imidazol-4-yl)phenol |
|---|---|
| PubChem CID | 115037876 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-(2-tert-butyl-5-methyl-1H-imidazol-4-yl)phenol |
| SMILES | Cc1[nH]c(C(C)(C)C)nc1-c1cccc(O)c1 |
| InChI | InChI=1S/C14H18N2O/c1-9-12(10-6-5-7-11(17)8-10)16-13(15-9)14(2,3)4/h5-8,17H,1-4H3,(H,15,16) |
| InChIKey | FBVFSTQPSITJPO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |