C10H10N2O2 — CID 105444052
4-(3-hydroxyphenyl)-5-methyl-1,3-dihydroimidazol-2-one (PubChem CID 105444052) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-5-methyl-1,3-dihydroimidazol-2-one.
| Compound Name | 4-(3-hydroxyphenyl)-5-methyl-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 105444052 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4-(3-hydroxyphenyl)-5-methyl-1,3-dihydroimidazol-2-one |
| SMILES | Cc1[nH]c(=O)[nH]c1-c1cccc(O)c1 |
| InChI | InChI=1S/C10H10N2O2/c1-6-9(12-10(14)11-6)7-3-2-4-8(13)5-7/h2-5,13H,1H3,(H2,11,12,14) |
| InChIKey | SCMRSNUTLIPRIU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |