C16H17N5 — CID 163213205
6-phenyl-8-N-propan-2-ylpyrido[3,2-d]pyrimidine-4,8-diamine (PubChem CID 163213205) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 6-phenyl-8-N-propan-2-ylpyrido[3,2-d]pyrimidine-4,8-diamine.
| Compound Name | 6-phenyl-8-N-propan-2-ylpyrido[3,2-d]pyrimidine-4,8-diamine |
|---|---|
| PubChem CID | 163213205 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 6-phenyl-8-N-propan-2-ylpyrido[3,2-d]pyrimidine-4,8-diamine |
| SMILES | CC(C)Nc1cc(-c2ccccc2)nc2c(N)ncnc12 |
| InChI | InChI=1S/C16H17N5/c1-10(2)20-13-8-12(11-6-4-3-5-7-11)21-15-14(13)18-9-19-16(15)17/h3-10H,1-2H3,(H,20,21)(H2,17,18,19) |
| InChIKey | FZFKYGGRGPPNQK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |