C20H20FN3 — CID 175056011
2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine (PubChem CID 175056011) has the molecular formula C20H20FN3 and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine.
| Compound Name | 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 175056011 |
| Molecular Formula | C20H20FN3 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine |
| SMILES | CC(C)Nc1cc(-c2ccccc2)nc(F)c1Nc1ccccc1 |
| InChI | InChI=1S/C20H20FN3/c1-14(2)22-18-13-17(15-9-5-3-6-10-15)24-20(21)19(18)23-16-11-7-4-8-12-16/h3-14,23H,1-2H3,(H,22,24) |
| InChIKey | XTWIZQBUMJCVDC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|