About 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine
2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine (PubChem CID 175056011) has the molecular formula C20H20FN3
and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine.
Molecular Properties
| Compound Name | 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine |
| PubChem CID | 175056011 |
| Molecular Formula | C20H20FN3 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine |
| SMILES | CC(C)Nc1cc(-c2ccccc2)nc(F)c1Nc1ccccc1 |
| InChI | InChI=1S/C20H20FN3/c1-14(2)22-18-13-17(15-9-5-3-6-10-15)24-20(21)19(18)23-16-11-7-4-8-12-16/h3-14,23H,1-2H3,(H,22,24) |
| InChIKey | XTWIZQBUMJCVDC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine?
The IUPAC name of 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine (CID 175056011) is 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine.
What is the SMILES notation for 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine?
The canonical SMILES for 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine is CC(C)Nc1cc(-c2ccccc2)nc(F)c1Nc1ccccc1.
What is the InChIKey of 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine?
The InChIKey is XTWIZQBUMJCVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FN3/c1-14(2)22-18-13-17(15-9-5-3-6-10-15)24-20(21)19(18)23-16-11-7-4-8-12-16/h3-14,23H,1-2H3,(H,22,24).
What are the key properties of 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine?
2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine has a molecular weight of 321.40 g/mol, XLogP of 5.45, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-N,6-diphenyl-4-N-propan-2-ylpyridine-3,4-diamine is sourced from PubChem (CID 175056011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).