C20H21N3 — CID 141497384
2-N,6-diphenyl-4-N-propan-2-ylpyridine-2,4-diamine (PubChem CID 141497384) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-N,6-diphenyl-4-N-propan-2-ylpyridine-2,4-diamine.
| Compound Name | 2-N,6-diphenyl-4-N-propan-2-ylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 141497384 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-N,6-diphenyl-4-N-propan-2-ylpyridine-2,4-diamine |
| SMILES | CC(C)Nc1cc(Nc2ccccc2)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H21N3/c1-15(2)21-18-13-19(16-9-5-3-6-10-16)23-20(14-18)22-17-11-7-4-8-12-17/h3-15H,1-2H3,(H2,21,22,23) |
| InChIKey | MQFPJROJJGKMPN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |