C22H18N4 — CID 3590842
2-methyl-N-phenyl-6-(5-phenyl-3-pyridinyl)pyrimidin-4-amine (PubChem CID 3590842) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-methyl-N-phenyl-6-(5-phenyl-3-pyridinyl)pyrimidin-4-amine.
| Compound Name | 2-methyl-N-phenyl-6-(5-phenyl-3-pyridinyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3590842 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-methyl-N-phenyl-6-(5-phenyl-3-pyridinyl)pyrimidin-4-amine |
| SMILES | Cc1nc(Nc2ccccc2)cc(-c2cncc(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C22H18N4/c1-16-24-21(13-22(25-16)26-20-10-6-3-7-11-20)19-12-18(14-23-15-19)17-8-4-2-5-9-17/h2-15H,1H3,(H,24,25,26) |
| InChIKey | NEFPSOFUPJMIMV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |