C29H24N4O — CID 3677248
2-methyl-6-[5-(4-methylphenyl)-3-pyridinyl]-N-(4-phenoxyphenyl)pyrimidin-4-amine (PubChem CID 3677248) has the molecular formula C29H24N4O and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-methyl-6-[5-(4-methylphenyl)-3-pyridinyl]-N-(4-phenoxyphenyl)pyrimidin-4-amine.
| Compound Name | 2-methyl-6-[5-(4-methylphenyl)-3-pyridinyl]-N-(4-phenoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3677248 |
| Molecular Formula | C29H24N4O |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-methyl-6-[5-(4-methylphenyl)-3-pyridinyl]-N-(4-phenoxyphenyl)pyrimidin-4-amine |
| SMILES | Cc1ccc(-c2cncc(-c3cc(Nc4ccc(Oc5ccccc5)cc4)nc(C)n3)c2)cc1 |
| InChI | InChI=1S/C29H24N4O/c1-20-8-10-22(11-9-20)23-16-24(19-30-18-23)28-17-29(32-21(2)31-28)33-25-12-14-27(15-13-25)34-26-6-4-3-5-7-26/h3-19H,1-2H3,(H,31,32,33) |
| InChIKey | NUDVJJTUZPVXNM-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |