C20H19N5O — CID 3701721
3-[[6-[5-(4-methoxyphenyl)-3-pyridinyl]-2-methylpyrimidin-4-yl]amino]propanenitrile (PubChem CID 3701721) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-[[6-[5-(4-methoxyphenyl)-3-pyridinyl]-2-methylpyrimidin-4-yl]amino]propanenitrile.
| Compound Name | 3-[[6-[5-(4-methoxyphenyl)-3-pyridinyl]-2-methylpyrimidin-4-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 3701721 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-[[6-[5-(4-methoxyphenyl)-3-pyridinyl]-2-methylpyrimidin-4-yl]amino]propanenitrile |
| SMILES | COc1ccc(-c2cncc(-c3cc(NCCC#N)nc(C)n3)c2)cc1 |
| InChI | InChI=1S/C20H19N5O/c1-14-24-19(11-20(25-14)23-9-3-8-21)17-10-16(12-22-13-17)15-4-6-18(26-2)7-5-15/h4-7,10-13H,3,9H2,1-2H3,(H,23,24,25) |
| InChIKey | VOZVFUKTINKMBX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|